C21H33N3O2 — CID 102541132
tert-butyl N-cyclopropyl-N-[5-(1-propylpiperidin-2-yl)-2-pyridinyl]carbamate (PubChem CID 102541132) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[5-(1-propylpiperidin-2-yl)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-cyclopropyl-N-[5-(1-propylpiperidin-2-yl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 102541132 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[5-(1-propylpiperidin-2-yl)-2-pyridinyl]carbamate |
| SMILES | CCCN1CCCCC1c1ccc(N(C(=O)OC(C)(C)C)C2CC2)nc1 |
| InChI | InChI=1S/C21H33N3O2/c1-5-13-23-14-7-6-8-18(23)16-9-12-19(22-15-16)24(17-10-11-17)20(25)26-21(2,3)4/h9,12,15,17-18H,5-8,10-11,13-14H2,1-4H3 |
| InChIKey | GYMCZHUKNAIDHB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |