C25H31N3O3 — CID 102541141
tert-butyl N-[5-(1-benzoylpiperidin-2-yl)-2-pyridinyl]-N-cyclopropylcarbamate (PubChem CID 102541141) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is tert-butyl N-[5-(1-benzoylpiperidin-2-yl)-2-pyridinyl]-N-cyclopropylcarbamate.
| Compound Name | tert-butyl N-[5-(1-benzoylpiperidin-2-yl)-2-pyridinyl]-N-cyclopropylcarbamate |
|---|---|
| PubChem CID | 102541141 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | tert-butyl N-[5-(1-benzoylpiperidin-2-yl)-2-pyridinyl]-N-cyclopropylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(c1ccc(C2CCCCN2C(=O)c2ccccc2)cn1)C1CC1 |
| InChI | InChI=1S/C25H31N3O3/c1-25(2,3)31-24(30)28(20-13-14-20)22-15-12-19(17-26-22)21-11-7-8-16-27(21)23(29)18-9-5-4-6-10-18/h4-6,9-10,12,15,17,20-21H,7-8,11,13-14,16H2,1-3H3 |
| InChIKey | HLZHBSPVJFKMKP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |