C22H23N3O — CID 102541890
[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]pyrrolidin-1-yl]-phenylmethanone (PubChem CID 102541890) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is [2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]pyrrolidin-1-yl]-phenylmethanone.
| Compound Name | [2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]pyrrolidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 102541890 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | [2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]pyrrolidin-1-yl]-phenylmethanone |
| SMILES | Cc1ccc(C)n1-c1ccc(C2CCCN2C(=O)c2ccccc2)cn1 |
| InChI | InChI=1S/C22H23N3O/c1-16-10-11-17(2)25(16)21-13-12-19(15-23-21)20-9-6-14-24(20)22(26)18-7-4-3-5-8-18/h3-5,7-8,10-13,15,20H,6,9,14H2,1-2H3 |
| InChIKey | YAXUZWSIHVEUGM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|