C19H27N3 — CID 102541889
5-(1-butylpyrrolidin-2-yl)-2-(2,5-dimethylpyrrol-1-yl)pyridine (PubChem CID 102541889) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is 5-(1-butylpyrrolidin-2-yl)-2-(2,5-dimethylpyrrol-1-yl)pyridine.
| Compound Name | 5-(1-butylpyrrolidin-2-yl)-2-(2,5-dimethylpyrrol-1-yl)pyridine |
|---|---|
| PubChem CID | 102541889 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 5-(1-butylpyrrolidin-2-yl)-2-(2,5-dimethylpyrrol-1-yl)pyridine |
| SMILES | CCCCN1CCCC1c1ccc(-n2c(C)ccc2C)nc1 |
| InChI | InChI=1S/C19H27N3/c1-4-5-12-21-13-6-7-18(21)17-10-11-19(20-14-17)22-15(2)8-9-16(22)3/h8-11,14,18H,4-7,12-13H2,1-3H3 |
| InChIKey | JRBUHRDFRPTAPR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|