C17H22N2 — CID 102543349
3-(1-butylpyrrolidin-2-yl)quinoline (PubChem CID 102543349) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 3-(1-butylpyrrolidin-2-yl)quinoline.
| Compound Name | 3-(1-butylpyrrolidin-2-yl)quinoline |
|---|---|
| PubChem CID | 102543349 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 3-(1-butylpyrrolidin-2-yl)quinoline |
| SMILES | CCCCN1CCCC1c1cnc2ccccc2c1 |
| InChI | InChI=1S/C17H22N2/c1-2-3-10-19-11-6-9-17(19)15-12-14-7-4-5-8-16(14)18-13-15/h4-5,7-8,12-13,17H,2-3,6,9-11H2,1H3 |
| InChIKey | GRQPEMKTUAJZNY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |