C15H16N2O — CID 124500175
1-[(2S)-2-quinolin-3-ylpyrrolidin-1-yl]ethanone (PubChem CID 124500175) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-[(2S)-2-quinolin-3-ylpyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(2S)-2-quinolin-3-ylpyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 124500175 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-[(2S)-2-quinolin-3-ylpyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@H]1c1cnc2ccccc2c1 |
| InChI | InChI=1S/C15H16N2O/c1-11(18)17-8-4-7-15(17)13-9-12-5-2-3-6-14(12)16-10-13/h2-3,5-6,9-10,15H,4,7-8H2,1H3/t15-/m0/s1 |
| InChIKey | FWBBQYJGQHCVEZ-HNNXBMFYSA-N |
| XLogP | 2.92 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |