C20H18N2O — CID 124500188
phenyl-[(2R)-2-quinolin-3-ylpyrrolidin-1-yl]methanone (PubChem CID 124500188) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is phenyl-[(2R)-2-quinolin-3-ylpyrrolidin-1-yl]methanone.
| Compound Name | phenyl-[(2R)-2-quinolin-3-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 124500188 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | phenyl-[(2R)-2-quinolin-3-ylpyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1)N1CCC[C@@H]1c1cnc2ccccc2c1 |
| InChI | InChI=1S/C20H18N2O/c23-20(15-7-2-1-3-8-15)22-12-6-11-19(22)17-13-16-9-4-5-10-18(16)21-14-17/h1-5,7-10,13-14,19H,6,11-12H2/t19-/m1/s1 |
| InChIKey | XPOYCDCWZWMQBH-LJQANCHMSA-N |
| XLogP | 4.21 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |