C15H15NOS — CID 60770024
phenyl-(2-thiophen-3-ylpyrrolidin-1-yl)methanone (PubChem CID 60770024) has the molecular formula C15H15NOS and a molecular weight of 257.36 g/mol. Its IUPAC name is phenyl-(2-thiophen-3-ylpyrrolidin-1-yl)methanone.
| Compound Name | phenyl-(2-thiophen-3-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 60770024 |
| Molecular Formula | C15H15NOS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | phenyl-(2-thiophen-3-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1ccccc1)N1CCCC1c1ccsc1 |
| InChI | InChI=1S/C15H15NOS/c17-15(12-5-2-1-3-6-12)16-9-4-7-14(16)13-8-10-18-11-13/h1-3,5-6,8,10-11,14H,4,7,9H2 |
| InChIKey | FTYHXMJZQYQSQU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |