C15H14BrNOS — CID 42961741
(4-bromophenyl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone (PubChem CID 42961741) has the molecular formula C15H14BrNOS and a molecular weight of 336.25 g/mol. Its IUPAC name is (4-bromophenyl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone.
| Compound Name | (4-bromophenyl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 42961741 |
| Molecular Formula | C15H14BrNOS |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | (4-bromophenyl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1ccc(Br)cc1)N1CCCC1c1ccsc1 |
| InChI | InChI=1S/C15H14BrNOS/c16-13-5-3-11(4-6-13)15(18)17-8-1-2-14(17)12-7-9-19-10-12/h3-7,9-10,14H,1-2,8H2 |
| InChIKey | BBSIUJQVKWJHPC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |