C15H13Br2NOS — CID 107980311
(3,5-dibromophenyl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone (PubChem CID 107980311) has the molecular formula C15H13Br2NOS and a molecular weight of 415.15 g/mol. Its IUPAC name is (3,5-dibromophenyl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone.
| Compound Name | (3,5-dibromophenyl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 107980311 |
| Molecular Formula | C15H13Br2NOS |
| Molecular Weight | 415.15 g/mol |
| Exact Mass | 412.91 |
| IUPAC Name | (3,5-dibromophenyl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cc(Br)cc(Br)c1)N1CCCC1c1ccsc1 |
| InChI | InChI=1S/C15H13Br2NOS/c16-12-6-11(7-13(17)8-12)15(19)18-4-1-2-14(18)10-3-5-20-9-10/h3,5-9,14H,1-2,4H2 |
| InChIKey | ORXDMQLSWWLGBN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.15 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |