C16H20N2 — CID 102544425
6-(1-propylpyrrolidin-2-yl)quinoline (PubChem CID 102544425) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 6-(1-propylpyrrolidin-2-yl)quinoline.
| Compound Name | 6-(1-propylpyrrolidin-2-yl)quinoline |
|---|---|
| PubChem CID | 102544425 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 6-(1-propylpyrrolidin-2-yl)quinoline |
| SMILES | CCCN1CCCC1c1ccc2ncccc2c1 |
| InChI | InChI=1S/C16H20N2/c1-2-10-18-11-4-6-16(18)14-7-8-15-13(12-14)5-3-9-17-15/h3,5,7-9,12,16H,2,4,6,10-11H2,1H3 |
| InChIKey | AXEXPZHMHALWFJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |