C15H25ClN2 — CID 171315964
3-(1-pentylpiperidin-2-yl)pyridine;hydrochloride (PubChem CID 171315964) has the molecular formula C15H25ClN2 and a molecular weight of 268.83 g/mol. Its IUPAC name is 3-(1-pentylpiperidin-2-yl)pyridine;hydrochloride.
| Compound Name | 3-(1-pentylpiperidin-2-yl)pyridine;hydrochloride |
|---|---|
| PubChem CID | 171315964 |
| Molecular Formula | C15H25ClN2 |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 3-(1-pentylpiperidin-2-yl)pyridine;hydrochloride |
| SMILES | CCCCCN1CCCCC1c1cccnc1.Cl |
| InChI | InChI=1S/C15H24N2.ClH/c1-2-3-5-11-17-12-6-4-9-15(17)14-8-7-10-16-13-14;/h7-8,10,13,15H,2-6,9,11-12H2,1H3;1H |
| InChIKey | ROXCPCCYWSDFIC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|