C19H24N2S — CID 40637351
3-[(2R)-1-(3-phenylsulfanylpropyl)piperidin-2-yl]pyridine (PubChem CID 40637351) has the molecular formula C19H24N2S and a molecular weight of 312.48 g/mol. Its IUPAC name is 3-[(2R)-1-(3-phenylsulfanylpropyl)piperidin-2-yl]pyridine.
| Compound Name | 3-[(2R)-1-(3-phenylsulfanylpropyl)piperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 40637351 |
| Molecular Formula | C19H24N2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 3-[(2R)-1-(3-phenylsulfanylpropyl)piperidin-2-yl]pyridine |
| SMILES | c1ccc(SCCCN2CCCC[C@@H]2c2cccnc2)cc1 |
| InChI | InChI=1S/C19H24N2S/c1-2-9-18(10-3-1)22-15-7-14-21-13-5-4-11-19(21)17-8-6-12-20-16-17/h1-3,6,8-10,12,16,19H,4-5,7,11,13-15H2/t19-/m1/s1 |
| InChIKey | OKQKJELGHSNSRH-LJQANCHMSA-N |
| XLogP | 4.79 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|