C20H26N3O3- — CID 163152900
N-oxido-N-[3-[4-[(2S)-2-pyridin-3-ylpiperidin-1-yl]butoxy]phenyl]hydroxylamine (PubChem CID 163152900) has the molecular formula C20H26N3O3- and a molecular weight of 356.45 g/mol. Its IUPAC name is N-oxido-N-[3-[4-[(2S)-2-pyridin-3-ylpiperidin-1-yl]butoxy]phenyl]hydroxylamine.
| Compound Name | N-oxido-N-[3-[4-[(2S)-2-pyridin-3-ylpiperidin-1-yl]butoxy]phenyl]hydroxylamine |
|---|---|
| PubChem CID | 163152900 |
| Molecular Formula | C20H26N3O3- |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-oxido-N-[3-[4-[(2S)-2-pyridin-3-ylpiperidin-1-yl]butoxy]phenyl]hydroxylamine |
| SMILES | [O-]N(O)c1cccc(OCCCCN2CCCC[C@H]2c2cccnc2)c1 |
| InChI | InChI=1S/C20H26N3O3/c24-23(25)18-8-5-9-19(15-18)26-14-4-3-13-22-12-2-1-10-20(22)17-7-6-11-21-16-17/h5-9,11,15-16,20,24H,1-4,10,12-14H2/q-1/t20-/m0/s1 |
| InChIKey | VYJNGHMRZHZKGT-FQEVSTJZSA-N |
| XLogP | 4.16 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|