C20H25N3O3 — CID 40637291
3-[(2R)-1-[4-(3-nitrophenoxy)butyl]piperidin-2-yl]pyridine (PubChem CID 40637291) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-[(2R)-1-[4-(3-nitrophenoxy)butyl]piperidin-2-yl]pyridine.
| Compound Name | 3-[(2R)-1-[4-(3-nitrophenoxy)butyl]piperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 40637291 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 3-[(2R)-1-[4-(3-nitrophenoxy)butyl]piperidin-2-yl]pyridine |
| SMILES | O=[N+]([O-])c1cccc(OCCCCN2CCCC[C@@H]2c2cccnc2)c1 |
| InChI | InChI=1S/C20H25N3O3/c24-23(25)18-8-5-9-19(15-18)26-14-4-3-13-22-12-2-1-10-20(22)17-7-6-11-21-16-17/h5-9,11,15-16,20H,1-4,10,12-14H2/t20-/m1/s1 |
| InChIKey | XAGQTFBAYYCYRO-HXUWFJFHSA-N |
| XLogP | 4.38 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|