C22H28N2O2 — CID 40805651
3-[(2R)-1-[2-(4-methoxy-2-prop-2-enylphenoxy)ethyl]piperidin-2-yl]pyridine (PubChem CID 40805651) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 3-[(2R)-1-[2-(4-methoxy-2-prop-2-enylphenoxy)ethyl]piperidin-2-yl]pyridine.
| Compound Name | 3-[(2R)-1-[2-(4-methoxy-2-prop-2-enylphenoxy)ethyl]piperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 40805651 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 3-[(2R)-1-[2-(4-methoxy-2-prop-2-enylphenoxy)ethyl]piperidin-2-yl]pyridine |
| SMILES | C=CCc1cc(OC)ccc1OCCN1CCCC[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C22H28N2O2/c1-3-7-18-16-20(25-2)10-11-22(18)26-15-14-24-13-5-4-9-21(24)19-8-6-12-23-17-19/h3,6,8,10-12,16-17,21H,1,4-5,7,9,13-15H2,2H3/t21-/m1/s1 |
| InChIKey | CPDRDUXZXMJPET-OAQYLSRUSA-N |
| XLogP | 4.42 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|