C23H30N2O7 — CID 44668223
3-[1-[2-[2-(2-methoxyphenoxy)ethoxy]ethyl]piperidin-2-yl]pyridine;oxalic acid (PubChem CID 44668223) has the molecular formula C23H30N2O7 and a molecular weight of 446.50 g/mol. Its IUPAC name is 3-[1-[2-[2-(2-methoxyphenoxy)ethoxy]ethyl]piperidin-2-yl]pyridine;oxalic acid.
| Compound Name | 3-[1-[2-[2-(2-methoxyphenoxy)ethoxy]ethyl]piperidin-2-yl]pyridine;oxalic acid |
|---|---|
| PubChem CID | 44668223 |
| Molecular Formula | C23H30N2O7 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 3-[1-[2-[2-(2-methoxyphenoxy)ethoxy]ethyl]piperidin-2-yl]pyridine;oxalic acid |
| SMILES | COc1ccccc1OCCOCCN1CCCCC1c1cccnc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H28N2O3.C2H2O4/c1-24-20-9-2-3-10-21(20)26-16-15-25-14-13-23-12-5-4-8-19(23)18-7-6-11-22-17-18;3-1(4)2(5)6/h2-3,6-7,9-11,17,19H,4-5,8,12-16H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | JUWGPGCTHOYIAB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|