C24H30N2O6 — CID 44667573
3-[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]piperidin-2-yl]pyridine;oxalic acid (PubChem CID 44667573) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is 3-[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]piperidin-2-yl]pyridine;oxalic acid.
| Compound Name | 3-[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]piperidin-2-yl]pyridine;oxalic acid |
|---|---|
| PubChem CID | 44667573 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 3-[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]piperidin-2-yl]pyridine;oxalic acid |
| SMILES | C=CCc1ccc(OCCN2CCCCC2c2cccnc2)c(OC)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H28N2O2.C2H2O4/c1-3-7-18-10-11-21(22(16-18)25-2)26-15-14-24-13-5-4-9-20(24)19-8-6-12-23-17-19;3-1(4)2(5)6/h3,6,8,10-12,16-17,20H,1,4-5,7,9,13-15H2,2H3;(H,3,4)(H,5,6) |
| InChIKey | XKEHPNVQPVNUQE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|