C24H27ClN2O2 — CID 40637375
3-[(2S)-1-[2-[2-(4-chloronaphthalen-1-yl)oxyethoxy]ethyl]piperidin-2-yl]pyridine (PubChem CID 40637375) has the molecular formula C24H27ClN2O2 and a molecular weight of 410.95 g/mol. Its IUPAC name is 3-[(2S)-1-[2-[2-(4-chloronaphthalen-1-yl)oxyethoxy]ethyl]piperidin-2-yl]pyridine.
| Compound Name | 3-[(2S)-1-[2-[2-(4-chloronaphthalen-1-yl)oxyethoxy]ethyl]piperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 40637375 |
| Molecular Formula | C24H27ClN2O2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3-[(2S)-1-[2-[2-(4-chloronaphthalen-1-yl)oxyethoxy]ethyl]piperidin-2-yl]pyridine |
| SMILES | Clc1ccc(OCCOCCN2CCCC[C@H]2c2cccnc2)c2ccccc12 |
| InChI | InChI=1S/C24H27ClN2O2/c25-22-10-11-24(21-8-2-1-7-20(21)22)29-17-16-28-15-14-27-13-4-3-9-23(27)19-6-5-12-26-18-19/h1-2,5-8,10-12,18,23H,3-4,9,13-17H2/t23-/m0/s1 |
| InChIKey | XJRGGTBCZSMPKH-QHCPKHFHSA-N |
| XLogP | 5.51 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|