C16H27N2O4P — CID 7069814
diethyl 2-[(2R)-2-pyridin-3-ylpiperidin-1-yl]ethyl phosphate (PubChem CID 7069814) has the molecular formula C16H27N2O4P and a molecular weight of 342.38 g/mol. Its IUPAC name is diethyl 2-[(2R)-2-pyridin-3-ylpiperidin-1-yl]ethyl phosphate.
| Compound Name | diethyl 2-[(2R)-2-pyridin-3-ylpiperidin-1-yl]ethyl phosphate |
|---|---|
| PubChem CID | 7069814 |
| Molecular Formula | C16H27N2O4P |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | diethyl 2-[(2R)-2-pyridin-3-ylpiperidin-1-yl]ethyl phosphate |
| SMILES | CCOP(=O)(OCC)OCCN1CCCC[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C16H27N2O4P/c1-3-20-23(19,21-4-2)22-13-12-18-11-6-5-9-16(18)15-8-7-10-17-14-15/h7-8,10,14,16H,3-6,9,11-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | RPYOYJSKUKGJFB-MRXNPFEDSA-N |
| XLogP | 3.81 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|