C18H23ClN4O4 — CID 120755450
1-[2-(4-methoxy-2-nitrophenoxy)ethyl]-2-pyridin-3-ylpiperazine;hydrochloride (PubChem CID 120755450) has the molecular formula C18H23ClN4O4 and a molecular weight of 394.86 g/mol. Its IUPAC name is 1-[2-(4-methoxy-2-nitrophenoxy)ethyl]-2-pyridin-3-ylpiperazine;hydrochloride.
| Compound Name | 1-[2-(4-methoxy-2-nitrophenoxy)ethyl]-2-pyridin-3-ylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120755450 |
| Molecular Formula | C18H23ClN4O4 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-[2-(4-methoxy-2-nitrophenoxy)ethyl]-2-pyridin-3-ylpiperazine;hydrochloride |
| SMILES | COc1ccc(OCCN2CCNCC2c2cccnc2)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C18H22N4O4.ClH/c1-25-15-4-5-18(16(11-15)22(23)24)26-10-9-21-8-7-20-13-17(21)14-3-2-6-19-12-14;/h2-6,11-12,17,20H,7-10,13H2,1H3;1H |
| InChIKey | OROCXUMFISMZDI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|