C11H18N4 — CID 120754253
2-(2-pyridin-3-ylpiperazin-1-yl)ethanamine (PubChem CID 120754253) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(2-pyridin-3-ylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(2-pyridin-3-ylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 120754253 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-(2-pyridin-3-ylpiperazin-1-yl)ethanamine |
| SMILES | NCCN1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C11H18N4/c12-3-6-15-7-5-14-9-11(15)10-2-1-4-13-8-10/h1-2,4,8,11,14H,3,5-7,9,12H2 |
| InChIKey | FDFZMMWEYIONHE-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |