C16H22Cl2N4 — CID 120755310
2-pyridin-3-yl-1-(2-pyridin-3-ylethyl)piperazine;dihydrochloride (PubChem CID 120755310) has the molecular formula C16H22Cl2N4 and a molecular weight of 341.29 g/mol. Its IUPAC name is 2-pyridin-3-yl-1-(2-pyridin-3-ylethyl)piperazine;dihydrochloride.
| Compound Name | 2-pyridin-3-yl-1-(2-pyridin-3-ylethyl)piperazine;dihydrochloride |
|---|---|
| PubChem CID | 120755310 |
| Molecular Formula | C16H22Cl2N4 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-pyridin-3-yl-1-(2-pyridin-3-ylethyl)piperazine;dihydrochloride |
| SMILES | Cl.Cl.c1cncc(CCN2CCNCC2c2cccnc2)c1 |
| InChI | InChI=1S/C16H20N4.2ClH/c1-3-14(11-17-6-1)5-9-20-10-8-19-13-16(20)15-4-2-7-18-12-15;;/h1-4,6-7,11-12,16,19H,5,8-10,13H2;2*1H |
| InChIKey | SFXWYXMRNGGAGI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |