C18H23ClN4O — CID 120755244
N-benzyl-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride (PubChem CID 120755244) has the molecular formula C18H23ClN4O and a molecular weight of 346.86 g/mol. Its IUPAC name is N-benzyl-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride.
| Compound Name | N-benzyl-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120755244 |
| Molecular Formula | C18H23ClN4O |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-benzyl-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CN1CCNCC1c1cccnc1)NCc1ccccc1 |
| InChI | InChI=1S/C18H22N4O.ClH/c23-18(21-11-15-5-2-1-3-6-15)14-22-10-9-20-13-17(22)16-7-4-8-19-12-16;/h1-8,12,17,20H,9-11,13-14H2,(H,21,23);1H |
| InChIKey | BISSGYRIIYNFAO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |