C20H28Cl2N4O — CID 120758254
2-[2-(4-ethylphenyl)piperazin-1-yl]-N-(pyridin-3-ylmethyl)acetamide;dihydrochloride (PubChem CID 120758254) has the molecular formula C20H28Cl2N4O and a molecular weight of 411.38 g/mol. Its IUPAC name is 2-[2-(4-ethylphenyl)piperazin-1-yl]-N-(pyridin-3-ylmethyl)acetamide;dihydrochloride.
| Compound Name | 2-[2-(4-ethylphenyl)piperazin-1-yl]-N-(pyridin-3-ylmethyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120758254 |
| Molecular Formula | C20H28Cl2N4O |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-[2-(4-ethylphenyl)piperazin-1-yl]-N-(pyridin-3-ylmethyl)acetamide;dihydrochloride |
| SMILES | CCc1ccc(C2CNCCN2CC(=O)NCc2cccnc2)cc1.Cl.Cl |
| InChI | InChI=1S/C20H26N4O.2ClH/c1-2-16-5-7-18(8-6-16)19-14-22-10-11-24(19)15-20(25)23-13-17-4-3-9-21-12-17;;/h3-9,12,19,22H,2,10-11,13-15H2,1H3,(H,23,25);2*1H |
| InChIKey | SSMDAMSSHOATGW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |