C22H29ClN4O2 — CID 120758000
N-(4-acetamidophenyl)-2-[2-(4-ethylphenyl)piperazin-1-yl]acetamide;hydrochloride (PubChem CID 120758000) has the molecular formula C22H29ClN4O2 and a molecular weight of 416.95 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-[2-(4-ethylphenyl)piperazin-1-yl]acetamide;hydrochloride.
| Compound Name | N-(4-acetamidophenyl)-2-[2-(4-ethylphenyl)piperazin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120758000 |
| Molecular Formula | C22H29ClN4O2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | N-(4-acetamidophenyl)-2-[2-(4-ethylphenyl)piperazin-1-yl]acetamide;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2CC(=O)Nc2ccc(NC(C)=O)cc2)cc1.Cl |
| InChI | InChI=1S/C22H28N4O2.ClH/c1-3-17-4-6-18(7-5-17)21-14-23-12-13-26(21)15-22(28)25-20-10-8-19(9-11-20)24-16(2)27;/h4-11,21,23H,3,12-15H2,1-2H3,(H,24,27)(H,25,28);1H |
| InChIKey | UNXXDPRWBSFKMN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |