C19H22N4O3 — CID 120755646
N-(1,3-benzodioxol-5-ylmethyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide (PubChem CID 120755646) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 120755646 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide |
| SMILES | O=C(CN1CCNCC1c1cccnc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H22N4O3/c24-19(22-9-14-3-4-17-18(8-14)26-13-25-17)12-23-7-6-21-11-16(23)15-2-1-5-20-10-15/h1-5,8,10,16,21H,6-7,9,11-13H2,(H,22,24) |
| InChIKey | VWTQZBXXBHXTLZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |