C21H29ClN4O — CID 120756007
N-[1-(4-ethylphenyl)ethyl]-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride (PubChem CID 120756007) has the molecular formula C21H29ClN4O and a molecular weight of 388.94 g/mol. Its IUPAC name is N-[1-(4-ethylphenyl)ethyl]-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride.
| Compound Name | N-[1-(4-ethylphenyl)ethyl]-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120756007 |
| Molecular Formula | C21H29ClN4O |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-[1-(4-ethylphenyl)ethyl]-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride |
| SMILES | CCc1ccc(C(C)NC(=O)CN2CCNCC2c2cccnc2)cc1.Cl |
| InChI | InChI=1S/C21H28N4O.ClH/c1-3-17-6-8-18(9-7-17)16(2)24-21(26)15-25-12-11-23-14-20(25)19-5-4-10-22-13-19;/h4-10,13,16,20,23H,3,11-12,14-15H2,1-2H3,(H,24,26);1H |
| InChIKey | FAJOVWMJTUTFQT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |