C18H22ClN3O2 — CID 120767725
methyl 4-[(2-pyridin-3-ylpiperazin-1-yl)methyl]benzoate;hydrochloride (PubChem CID 120767725) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is methyl 4-[(2-pyridin-3-ylpiperazin-1-yl)methyl]benzoate;hydrochloride.
| Compound Name | methyl 4-[(2-pyridin-3-ylpiperazin-1-yl)methyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 120767725 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | methyl 4-[(2-pyridin-3-ylpiperazin-1-yl)methyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(CN2CCNCC2c2cccnc2)cc1.Cl |
| InChI | InChI=1S/C18H21N3O2.ClH/c1-23-18(22)15-6-4-14(5-7-15)13-21-10-9-20-12-17(21)16-3-2-8-19-11-16;/h2-8,11,17,20H,9-10,12-13H2,1H3;1H |
| InChIKey | BSNCEZRAVIXYFJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |