C18H24ClN3OS — CID 120754750
1-[(3-methoxy-4-methylsulfanylphenyl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride (PubChem CID 120754750) has the molecular formula C18H24ClN3OS and a molecular weight of 365.93 g/mol. Its IUPAC name is 1-[(3-methoxy-4-methylsulfanylphenyl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride.
| Compound Name | 1-[(3-methoxy-4-methylsulfanylphenyl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120754750 |
| Molecular Formula | C18H24ClN3OS |
| Molecular Weight | 365.93 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 1-[(3-methoxy-4-methylsulfanylphenyl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride |
| SMILES | COc1cc(CN2CCNCC2c2cccnc2)ccc1SC.Cl |
| InChI | InChI=1S/C18H23N3OS.ClH/c1-22-17-10-14(5-6-18(17)23-2)13-21-9-8-20-12-16(21)15-4-3-7-19-11-15;/h3-7,10-11,16,20H,8-9,12-13H2,1-2H3;1H |
| InChIKey | JMVJEPOEDYTOND-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.93 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |