C16H21ClN4O2 — CID 120768227
methyl 5-[(2-pyridin-3-ylpiperazin-1-yl)methyl]-1H-pyrrole-2-carboxylate;hydrochloride (PubChem CID 120768227) has the molecular formula C16H21ClN4O2 and a molecular weight of 336.82 g/mol. Its IUPAC name is methyl 5-[(2-pyridin-3-ylpiperazin-1-yl)methyl]-1H-pyrrole-2-carboxylate;hydrochloride.
| Compound Name | methyl 5-[(2-pyridin-3-ylpiperazin-1-yl)methyl]-1H-pyrrole-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 120768227 |
| Molecular Formula | C16H21ClN4O2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | methyl 5-[(2-pyridin-3-ylpiperazin-1-yl)methyl]-1H-pyrrole-2-carboxylate;hydrochloride |
| SMILES | COC(=O)c1ccc(CN2CCNCC2c2cccnc2)[nH]1.Cl |
| InChI | InChI=1S/C16H20N4O2.ClH/c1-22-16(21)14-5-4-13(19-14)11-20-8-7-18-10-15(20)12-3-2-6-17-9-12;/h2-6,9,15,18-19H,7-8,10-11H2,1H3;1H |
| InChIKey | YCPLDGWQGMIFKN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |