C15H21N5O2 — CID 120912318
methyl 5-[[2-(1-methylimidazol-2-yl)piperazin-1-yl]methyl]-1H-pyrrole-2-carboxylate (PubChem CID 120912318) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is methyl 5-[[2-(1-methylimidazol-2-yl)piperazin-1-yl]methyl]-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 5-[[2-(1-methylimidazol-2-yl)piperazin-1-yl]methyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 120912318 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | methyl 5-[[2-(1-methylimidazol-2-yl)piperazin-1-yl]methyl]-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2CCNCC2c2nccn2C)[nH]1 |
| InChI | InChI=1S/C15H21N5O2/c1-19-7-6-17-14(19)13-9-16-5-8-20(13)10-11-3-4-12(18-11)15(21)22-2/h3-4,6-7,13,16,18H,5,8-10H2,1-2H3 |
| InChIKey | HNMRDPQWQCWTJI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |