C14H21ClN4OS — CID 120912331
1-[(3-methoxythiophen-2-yl)methyl]-2-(1-methylimidazol-2-yl)piperazine;hydrochloride (PubChem CID 120912331) has the molecular formula C14H21ClN4OS and a molecular weight of 328.87 g/mol. Its IUPAC name is 1-[(3-methoxythiophen-2-yl)methyl]-2-(1-methylimidazol-2-yl)piperazine;hydrochloride.
| Compound Name | 1-[(3-methoxythiophen-2-yl)methyl]-2-(1-methylimidazol-2-yl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120912331 |
| Molecular Formula | C14H21ClN4OS |
| Molecular Weight | 328.87 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-[(3-methoxythiophen-2-yl)methyl]-2-(1-methylimidazol-2-yl)piperazine;hydrochloride |
| SMILES | COc1ccsc1CN1CCNCC1c1nccn1C.Cl |
| InChI | InChI=1S/C14H20N4OS.ClH/c1-17-6-5-16-14(17)11-9-15-4-7-18(11)10-13-12(19-2)3-8-20-13;/h3,5-6,8,11,15H,4,7,9-10H2,1-2H3;1H |
| InChIKey | KMYMIDVQEHNQLE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.87 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |