C17H24N4O2 — CID 120911740
1-[(3,5-dimethoxyphenyl)methyl]-2-(1-methylimidazol-2-yl)piperazine (PubChem CID 120911740) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 1-[(3,5-dimethoxyphenyl)methyl]-2-(1-methylimidazol-2-yl)piperazine.
| Compound Name | 1-[(3,5-dimethoxyphenyl)methyl]-2-(1-methylimidazol-2-yl)piperazine |
|---|---|
| PubChem CID | 120911740 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-[(3,5-dimethoxyphenyl)methyl]-2-(1-methylimidazol-2-yl)piperazine |
| SMILES | COc1cc(CN2CCNCC2c2nccn2C)cc(OC)c1 |
| InChI | InChI=1S/C17H24N4O2/c1-20-6-5-19-17(20)16-11-18-4-7-21(16)12-13-8-14(22-2)10-15(9-13)23-3/h5-6,8-10,16,18H,4,7,11-12H2,1-3H3 |
| InChIKey | NVEYSNPXICFNHB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |