C12H22ClN5O — CID 120967367
N-ethyl-2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]acetamide;hydrochloride (PubChem CID 120967367) has the molecular formula C12H22ClN5O and a molecular weight of 287.80 g/mol. Its IUPAC name is N-ethyl-2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]acetamide;hydrochloride.
| Compound Name | N-ethyl-2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120967367 |
| Molecular Formula | C12H22ClN5O |
| Molecular Weight | 287.80 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N-ethyl-2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]acetamide;hydrochloride |
| SMILES | CCNC(=O)CN1CCNCC1c1nccn1C.Cl |
| InChI | InChI=1S/C12H21N5O.ClH/c1-3-14-11(18)9-17-7-4-13-8-10(17)12-15-5-6-16(12)2;/h5-6,10,13H,3-4,7-9H2,1-2H3,(H,14,18);1H |
| InChIKey | ZWSGUOHBTZCDAZ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.80 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |