C21H31N5O2 — CID 120870543
2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-[[2-(propoxymethyl)phenyl]methyl]acetamide (PubChem CID 120870543) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-[[2-(propoxymethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-[[2-(propoxymethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 120870543 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-[[2-(propoxymethyl)phenyl]methyl]acetamide |
| SMILES | CCCOCc1ccccc1CNC(=O)CN1CCNCC1c1nccn1C |
| InChI | InChI=1S/C21H31N5O2/c1-3-12-28-16-18-7-5-4-6-17(18)13-24-20(27)15-26-11-8-22-14-19(26)21-23-9-10-25(21)2/h4-7,9-10,19,22H,3,8,11-16H2,1-2H3,(H,24,27) |
| InChIKey | DFQLNSBUOMBZLD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|