C18H26ClN5O — CID 120869985
2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-(1-phenylethyl)acetamide;hydrochloride (PubChem CID 120869985) has the molecular formula C18H26ClN5O and a molecular weight of 363.89 g/mol. Its IUPAC name is 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-(1-phenylethyl)acetamide;hydrochloride.
| Compound Name | 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-(1-phenylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120869985 |
| Molecular Formula | C18H26ClN5O |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-(1-phenylethyl)acetamide;hydrochloride |
| SMILES | CC(NC(=O)CN1CCNCC1c1nccn1C)c1ccccc1.Cl |
| InChI | InChI=1S/C18H25N5O.ClH/c1-14(15-6-4-3-5-7-15)21-17(24)13-23-11-8-19-12-16(23)18-20-9-10-22(18)2;/h3-7,9-10,14,16,19H,8,11-13H2,1-2H3,(H,21,24);1H |
| InChIKey | OCLQUKLPMPCWOM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |