C20H29N5O — CID 120870751
2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-(2-methyl-1-phenylpropyl)acetamide (PubChem CID 120870751) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-(2-methyl-1-phenylpropyl)acetamide.
| Compound Name | 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-(2-methyl-1-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 120870751 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-(2-methyl-1-phenylpropyl)acetamide |
| SMILES | CC(C)C(NC(=O)CN1CCNCC1c1nccn1C)c1ccccc1 |
| InChI | InChI=1S/C20H29N5O/c1-15(2)19(16-7-5-4-6-8-16)23-18(26)14-25-12-9-21-13-17(25)20-22-10-11-24(20)3/h4-8,10-11,15,17,19,21H,9,12-14H2,1-3H3,(H,23,26) |
| InChIKey | ZSSPTYMTWFUKKT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |