C17H29N5O — CID 120870391
N-cycloheptyl-2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]acetamide (PubChem CID 120870391) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is N-cycloheptyl-2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]acetamide.
| Compound Name | N-cycloheptyl-2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 120870391 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | N-cycloheptyl-2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]acetamide |
| SMILES | Cn1ccnc1C1CNCCN1CC(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C17H29N5O/c1-21-10-9-19-17(21)15-12-18-8-11-22(15)13-16(23)20-14-6-4-2-3-5-7-14/h9-10,14-15,18H,2-8,11-13H2,1H3,(H,20,23) |
| InChIKey | FYDIUNVSFYWSAO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |