C18H31N5O — CID 120870995
N-(cyclohexylmethyl)-N-methyl-2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]acetamide (PubChem CID 120870995) has the molecular formula C18H31N5O and a molecular weight of 333.48 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N-methyl-2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]acetamide.
| Compound Name | N-(cyclohexylmethyl)-N-methyl-2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 120870995 |
| Molecular Formula | C18H31N5O |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | N-(cyclohexylmethyl)-N-methyl-2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]acetamide |
| SMILES | CN(CC1CCCCC1)C(=O)CN1CCNCC1c1nccn1C |
| InChI | InChI=1S/C18H31N5O/c1-21-10-9-20-18(21)16-12-19-8-11-23(16)14-17(24)22(2)13-15-6-4-3-5-7-15/h9-10,15-16,19H,3-8,11-14H2,1-2H3 |
| InChIKey | LESQLVNMZNRYKH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |