C19H26FN5O — CID 120871375
N-ethyl-N-[(3-fluorophenyl)methyl]-2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]acetamide (PubChem CID 120871375) has the molecular formula C19H26FN5O and a molecular weight of 359.45 g/mol. Its IUPAC name is N-ethyl-N-[(3-fluorophenyl)methyl]-2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]acetamide.
| Compound Name | N-ethyl-N-[(3-fluorophenyl)methyl]-2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 120871375 |
| Molecular Formula | C19H26FN5O |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | N-ethyl-N-[(3-fluorophenyl)methyl]-2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]acetamide |
| SMILES | CCN(Cc1cccc(F)c1)C(=O)CN1CCNCC1c1nccn1C |
| InChI | InChI=1S/C19H26FN5O/c1-3-24(13-15-5-4-6-16(20)11-15)18(26)14-25-10-7-21-12-17(25)19-22-8-9-23(19)2/h4-6,8-9,11,17,21H,3,7,10,12-14H2,1-2H3 |
| InChIKey | FWYOEHSJCGYFDX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |