C17H20F3N5O — CID 120870665
2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 120870665) has the molecular formula C17H20F3N5O and a molecular weight of 367.38 g/mol. Its IUPAC name is 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 120870665 |
| Molecular Formula | C17H20F3N5O |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cn1ccnc1C1CNCCN1CC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H20F3N5O/c1-24-8-7-22-16(24)14-10-21-6-9-25(14)11-15(26)23-13-4-2-12(3-5-13)17(18,19)20/h2-5,7-8,14,21H,6,9-11H2,1H3,(H,23,26) |
| InChIKey | OTWHEBMZYOAWQN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |