C16H20F2N4O2S — CID 120870987
1-[[4-(difluoromethylsulfonyl)phenyl]methyl]-2-(1-methylimidazol-2-yl)piperazine (PubChem CID 120870987) has the molecular formula C16H20F2N4O2S and a molecular weight of 370.43 g/mol. Its IUPAC name is 1-[[4-(difluoromethylsulfonyl)phenyl]methyl]-2-(1-methylimidazol-2-yl)piperazine.
| Compound Name | 1-[[4-(difluoromethylsulfonyl)phenyl]methyl]-2-(1-methylimidazol-2-yl)piperazine |
|---|---|
| PubChem CID | 120870987 |
| Molecular Formula | C16H20F2N4O2S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-[[4-(difluoromethylsulfonyl)phenyl]methyl]-2-(1-methylimidazol-2-yl)piperazine |
| SMILES | Cn1ccnc1C1CNCCN1Cc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C16H20F2N4O2S/c1-21-8-7-20-15(21)14-10-19-6-9-22(14)11-12-2-4-13(5-3-12)25(23,24)16(17)18/h2-5,7-8,14,16,19H,6,9-11H2,1H3 |
| InChIKey | YMUZYSHXYYHRFP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |