C24H33ClN4O — CID 120755482
N-[cyclohexyl(phenyl)methyl]-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride (PubChem CID 120755482) has the molecular formula C24H33ClN4O and a molecular weight of 429.01 g/mol. Its IUPAC name is N-[cyclohexyl(phenyl)methyl]-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride.
| Compound Name | N-[cyclohexyl(phenyl)methyl]-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120755482 |
| Molecular Formula | C24H33ClN4O |
| Molecular Weight | 429.01 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-[cyclohexyl(phenyl)methyl]-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CN1CCNCC1c1cccnc1)NC(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C24H32N4O.ClH/c29-23(18-28-15-14-26-17-22(28)21-12-7-13-25-16-21)27-24(19-8-3-1-4-9-19)20-10-5-2-6-11-20;/h1,3-4,7-9,12-13,16,20,22,24,26H,2,5-6,10-11,14-15,17-18H2,(H,27,29);1H |
| InChIKey | PEVPKPZCXDOBQR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.01 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |