C23H31ClN4O2 — CID 120755783
N-[(4-phenyloxan-4-yl)methyl]-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride (PubChem CID 120755783) has the molecular formula C23H31ClN4O2 and a molecular weight of 430.98 g/mol. Its IUPAC name is N-[(4-phenyloxan-4-yl)methyl]-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride.
| Compound Name | N-[(4-phenyloxan-4-yl)methyl]-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120755783 |
| Molecular Formula | C23H31ClN4O2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | N-[(4-phenyloxan-4-yl)methyl]-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CN1CCNCC1c1cccnc1)NCC1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C23H30N4O2.ClH/c28-22(17-27-12-11-25-16-21(27)19-5-4-10-24-15-19)26-18-23(8-13-29-14-9-23)20-6-2-1-3-7-20;/h1-7,10,15,21,25H,8-9,11-14,16-18H2,(H,26,28);1H |
| InChIKey | XKKMJXRCEOYANU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |