C21H31ClN4O — CID 120755899
N-(1-adamantyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride (PubChem CID 120755899) has the molecular formula C21H31ClN4O and a molecular weight of 390.96 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride.
| Compound Name | N-(1-adamantyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120755899 |
| Molecular Formula | C21H31ClN4O |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | N-(1-adamantyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CN1CCNCC1c1cccnc1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H30N4O.ClH/c26-20(24-21-9-15-6-16(10-21)8-17(7-15)11-21)14-25-5-4-23-13-19(25)18-2-1-3-22-12-18;/h1-3,12,15-17,19,23H,4-11,13-14H2,(H,24,26);1H |
| InChIKey | CNDFVLGWPZAJLV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |