C12H18ClN3 — CID 120754736
1-prop-2-enyl-2-pyridin-3-ylpiperazine;hydrochloride (PubChem CID 120754736) has the molecular formula C12H18ClN3 and a molecular weight of 239.75 g/mol. Its IUPAC name is 1-prop-2-enyl-2-pyridin-3-ylpiperazine;hydrochloride.
| Compound Name | 1-prop-2-enyl-2-pyridin-3-ylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120754736 |
| Molecular Formula | C12H18ClN3 |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 1-prop-2-enyl-2-pyridin-3-ylpiperazine;hydrochloride |
| SMILES | C=CCN1CCNCC1c1cccnc1.Cl |
| InChI | InChI=1S/C12H17N3.ClH/c1-2-7-15-8-6-14-10-12(15)11-4-3-5-13-9-11;/h2-5,9,12,14H,1,6-8,10H2;1H |
| InChIKey | HSWFWKXSOULSPU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|