C14H17Cl2N3S — CID 120846434
1-[(3-chlorothiophen-2-yl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride (PubChem CID 120846434) has the molecular formula C14H17Cl2N3S and a molecular weight of 330.28 g/mol. Its IUPAC name is 1-[(3-chlorothiophen-2-yl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride.
| Compound Name | 1-[(3-chlorothiophen-2-yl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120846434 |
| Molecular Formula | C14H17Cl2N3S |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 1-[(3-chlorothiophen-2-yl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride |
| SMILES | Cl.Clc1ccsc1CN1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C14H16ClN3S.ClH/c15-12-3-7-19-14(12)10-18-6-5-17-9-13(18)11-2-1-4-16-8-11;/h1-4,7-8,13,17H,5-6,9-10H2;1H |
| InChIKey | TWRMSXQJNRFIQY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |