C12H16ClN5S — CID 120767683
4-[(2-pyridin-3-ylpiperazin-1-yl)methyl]thiadiazole;hydrochloride (PubChem CID 120767683) has the molecular formula C12H16ClN5S and a molecular weight of 297.81 g/mol. Its IUPAC name is 4-[(2-pyridin-3-ylpiperazin-1-yl)methyl]thiadiazole;hydrochloride.
| Compound Name | 4-[(2-pyridin-3-ylpiperazin-1-yl)methyl]thiadiazole;hydrochloride |
|---|---|
| PubChem CID | 120767683 |
| Molecular Formula | C12H16ClN5S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 4-[(2-pyridin-3-ylpiperazin-1-yl)methyl]thiadiazole;hydrochloride |
| SMILES | Cl.c1cncc(C2CNCCN2Cc2csnn2)c1 |
| InChI | InChI=1S/C12H15N5S.ClH/c1-2-10(6-13-3-1)12-7-14-4-5-17(12)8-11-9-18-16-15-11;/h1-3,6,9,12,14H,4-5,7-8H2;1H |
| InChIKey | RHNNVZLPVVOAJZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |