C14H16BrN3S — CID 120754795
1-[(5-bromothiophen-3-yl)methyl]-2-pyridin-3-ylpiperazine (PubChem CID 120754795) has the molecular formula C14H16BrN3S and a molecular weight of 338.27 g/mol. Its IUPAC name is 1-[(5-bromothiophen-3-yl)methyl]-2-pyridin-3-ylpiperazine.
| Compound Name | 1-[(5-bromothiophen-3-yl)methyl]-2-pyridin-3-ylpiperazine |
|---|---|
| PubChem CID | 120754795 |
| Molecular Formula | C14H16BrN3S |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 1-[(5-bromothiophen-3-yl)methyl]-2-pyridin-3-ylpiperazine |
| SMILES | Brc1cc(CN2CCNCC2c2cccnc2)cs1 |
| InChI | InChI=1S/C14H16BrN3S/c15-14-6-11(10-19-14)9-18-5-4-17-8-13(18)12-2-1-3-16-7-12/h1-3,6-7,10,13,17H,4-5,8-9H2 |
| InChIKey | SWJLMLXUKLRJLF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |